Products 1152568-80-3
CAS 1152568-80-3 is the registry number for 2-(Chloromethyl)-5-(2-fluorophenyl)-1,3-oxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-5-(2-fluorophenyl)-1,3-oxazole (CAS 1152568-80-3) is a chemical compound with the molecular formula C10H7ClFNO and a molecular weight of 211.62 g/mol. IUPAC name: 2-(chloromethyl)-5-(2-fluorophenyl)-1,3-oxazole. InChIKey: CVANLEQVUGAXSV-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO |
|---|---|
| Molecular weight | 211.62 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(2-fluorophenyl)-1,3-oxazole |
| InChIKey | CVANLEQVUGAXSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=C(O2)CCl)F |
Computed by PubChem (NCBI)