Products 2805200-69-3
CAS 2805200-69-3 is the registry number for 6'-Chloro-5'-fluorospiro[cyclopropane-1,3'-indolin]-2'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-5-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 2805200-69-3) is a chemical compound with the molecular formula C10H7ClFNO and a molecular weight of 211.62 g/mol. IUPAC name: 6-chloro-5-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: VYXVTLLHDZWMCF-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO |
|---|---|
| Molecular weight | 211.62 g/mol |
| IUPAC name | 6-chloro-5-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | VYXVTLLHDZWMCF-UHFFFAOYSA-N |
| SMILES | C1CC12C3=CC(=C(C=C3NC2=O)Cl)F |
Computed by PubChem (NCBI)