Products 22091-39-0
CAS 22091-39-0 appears in our catalog under these names: 4-(Chloromethyl)-2-(4-fluorophenyl)-1,3-oxazole, 95%, 4-(Chloromethyl)-2-(4-fluorophenyl)oxazole, 97%, 4–(Chloromethyl)–2–(4–fluorophenyl)oxazole, 4-(chloromethyl)-2-(4-fluorophenyl)-1,3-oxazole. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 2,5g.
4-(chloromethyl)-2-(4-fluorophenyl)-1,3-oxazole (CAS 22091-39-0) is a chemical compound with the molecular formula C10H7ClFNO and a molecular weight of 211.62 g/mol. IUPAC name: 4-(chloromethyl)-2-(4-fluorophenyl)-1,3-oxazole. InChIKey: GVPZSTFLDSJXRT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO |
|---|---|
| Molecular weight | 211.62 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(4-fluorophenyl)-1,3-oxazole |
| InChIKey | GVPZSTFLDSJXRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)CCl)F |
Computed by PubChem (NCBI)