CAS 1152604-44-8 appears in our catalog under these names: 1-(2,4-Difluorophenyl)-4-hydroxy-1H-pyrazole-3-carboxylic acid, 95%, 1-(2,4-Difluorophenyl)-4-hydroxy-1H-pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(2,4-difluorophenyl)-4-hydroxypyrazole-3-carboxylic acid (CAS 1152604-44-8) is a chemical compound with the molecular formula C10H6F2N2O3 and a molecular weight of 240.16 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-4-hydroxypyrazole-3-carboxylic acid. InChIKey: VNRMGIYUWUEYEC-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O3 |
|---|---|
| Molecular weight | 240.16 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-4-hydroxypyrazole-3-carboxylic acid |
| InChIKey | VNRMGIYUWUEYEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)N2C=C(C(=N2)C(=O)O)O |
Computed by PubChem (NCBI)