CAS 1788846-47-8 appears in our catalog under these names: 4-(5-(Difluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid, 95%, 4-(5-(Difluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS 1788846-47-8) is a chemical compound with the molecular formula C10H6F2N2O3 and a molecular weight of 240.16 g/mol. IUPAC name: 4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid. InChIKey: XEKGXUYBNOOCBV-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O3 |
|---|---|
| Molecular weight | 240.16 g/mol |
| IUPAC name | 4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| InChIKey | XEKGXUYBNOOCBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(F)F)C(=O)O |
Computed by PubChem (NCBI)