Products 2096986-06-8
CAS 2096986-06-8 is the registry number for 1-(3,5-Difluorophenyl)-5-hydroxy-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(3,5-difluorophenyl)-3-oxo-1H-pyrazole-4-carboxylic acid (CAS 2096986-06-8) is a chemical compound with the molecular formula C10H6F2N2O3 and a molecular weight of 240.16 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-3-oxo-1H-pyrazole-4-carboxylic acid. InChIKey: MNZGFXJMZRDFJJ-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O3 |
|---|---|
| Molecular weight | 240.16 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-3-oxo-1H-pyrazole-4-carboxylic acid |
| InChIKey | MNZGFXJMZRDFJJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)N2C(=O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)