Products 1152812-07-1
CAS 1152812-07-1 is the registry number for 2-(3-Fluorophenyl)-1-(p-tolyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-fluorophenyl)-1-(4-methylphenyl)ethanone (CAS 1152812-07-1) is a chemical compound with the molecular formula C15H13FO and a molecular weight of 228.26 g/mol. IUPAC name: 2-(3-fluorophenyl)-1-(4-methylphenyl)ethanone. InChIKey: CQMCKZVZAKFLKX-UHFFFAOYSA-N.
| Molecular formula | C15H13FO |
|---|---|
| Molecular weight | 228.26 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1-(4-methylphenyl)ethanone |
| InChIKey | CQMCKZVZAKFLKX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)