Products 684270-36-8
CAS 684270-36-8 is the registry number for 2-(4-Fluorophenyl)-1-(4-methylphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(4-fluorophenyl)-1-(4-methylphenyl)ethanone (CAS 684270-36-8) is a chemical compound with the molecular formula C15H13FO and a molecular weight of 228.26 g/mol. IUPAC name: 2-(4-fluorophenyl)-1-(4-methylphenyl)ethanone. InChIKey: ZVXZTZFHRJQQCQ-UHFFFAOYSA-N.
| Molecular formula | C15H13FO |
|---|---|
| Molecular weight | 228.26 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1-(4-methylphenyl)ethanone |
| InChIKey | ZVXZTZFHRJQQCQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)