CAS 1345471-18-2 is the registry number for 4-Acetyl-3'-fluoro-4'-methylbiphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[4-(3-fluoro-4-methylphenyl)phenyl]ethanone (CAS 1345471-18-2) is a chemical compound with the molecular formula C15H13FO and a molecular weight of 228.26 g/mol. IUPAC name: 1-[4-(3-fluoro-4-methylphenyl)phenyl]ethanone. InChIKey: YTYXPYVWTUVHDM-UHFFFAOYSA-N.
| Molecular formula | C15H13FO |
|---|---|
| Molecular weight | 228.26 g/mol |
| IUPAC name | 1-[4-(3-fluoro-4-methylphenyl)phenyl]ethanone |
| InChIKey | YTYXPYVWTUVHDM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=C(C=C2)C(=O)C)F |
Computed by PubChem (NCBI)