CAS 115282-41-2 appears in our catalog under these names: 2-(4-(Dimethylamino)phenyl)-2-hydroxyacetic acid, 95+%, 4-Dimethylaminophenylglyoxal hydrate, 95+%, 4-Dimethylaminophenylglyoxal hydrate, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
2-[4-(dimethylamino)phenyl]-2-oxoacetaldehyde;hydrate (CAS 115282-41-2) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-[4-(dimethylamino)phenyl]-2-oxoacetaldehyde;hydrate. InChIKey: YOKMNOZLZXDGBI-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-[4-(dimethylamino)phenyl]-2-oxoacetaldehyde;hydrate |
| InChIKey | YOKMNOZLZXDGBI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)C=O.O |
Computed by PubChem (NCBI)