CAS 1171790-84-3 is the registry number for 4-Dimethylaminophenylglyoxal hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
2-[4-(dimethylamino)phenyl]-2-oxoacetaldehyde;hydrate (CAS 1171790-84-3) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-[4-(dimethylamino)phenyl]-2-oxoacetaldehyde;hydrate. InChIKey: YOKMNOZLZXDGBI-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-[4-(dimethylamino)phenyl]-2-oxoacetaldehyde;hydrate |
| InChIKey | YOKMNOZLZXDGBI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)C=O.O |
Computed by PubChem (NCBI)