Products 1152837-83-6
CAS 1152837-83-6 appears in our catalog under these names: 3-Amino-n,n-dimethyl-4-(propan-2-yloxy)benzene-1-sulfonamide, 95%, 3-Amino-N,N-dimethyl-4-(propan-2-yloxy)benzene-1-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
3-amino-N,N-dimethyl-4-propan-2-yloxybenzenesulfonamide (CAS 1152837-83-6) is a chemical compound with the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. IUPAC name: 3-amino-N,N-dimethyl-4-propan-2-yloxybenzenesulfonamide. InChIKey: UBEMSWNOQVVNLX-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 3-amino-N,N-dimethyl-4-propan-2-yloxybenzenesulfonamide |
| InChIKey | UBEMSWNOQVVNLX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)S(=O)(=O)N(C)C)N |
Computed by PubChem (NCBI)