CAS 921988-33-2 is the registry number for Methyl 2-((1R,3R)-3-amino-1-hydroxy-4-methylpentyl)thiazole-4-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(1R,3R)-3-amino-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate (CAS 921988-33-2) is a chemical compound with the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. IUPAC name: methyl 2-[(1R,3R)-3-amino-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate. InChIKey: NKCIHAKAWLMTAH-VXNVDRBHSA-N.
| Molecular formula | C11H18N2O3S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | methyl 2-[(1R,3R)-3-amino-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| InChIKey | NKCIHAKAWLMTAH-VXNVDRBHSA-N |
| SMILES | CC(C)[C@@H](C[C@H](C1=NC(=CS1)C(=O)OC)O)N |
Computed by PubChem (NCBI)