Products 1391732-43-6
CAS 1391732-43-6 is the registry number for tert-Butyl 3-oxohexahydropyrrolo[3,4-b][1,4]thiazine-6(2h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 3-oxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]thiazine-6-carboxylate (CAS 1391732-43-6) is a chemical compound with the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. IUPAC name: tert-butyl 3-oxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]thiazine-6-carboxylate. InChIKey: VFRZUNQGMFJYBO-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | tert-butyl 3-oxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]thiazine-6-carboxylate |
| InChIKey | VFRZUNQGMFJYBO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2C(C1)SCC(=O)N2 |
Computed by PubChem (NCBI)