Products 1152860-61-1
CAS 1152860-61-1 is the registry number for 4-Ethoxy-2,3-dimethylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-ethoxy-2,3-dimethylbenzenesulfonamide (CAS 1152860-61-1) is a chemical compound with the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. IUPAC name: 4-ethoxy-2,3-dimethylbenzenesulfonamide. InChIKey: FRMKTXVSUOALDH-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 4-ethoxy-2,3-dimethylbenzenesulfonamide |
| InChIKey | FRMKTXVSUOALDH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)S(=O)(=O)N)C)C |
Computed by PubChem (NCBI)