Products 1152868-20-6
CAS 1152868-20-6 appears in our catalog under these names: 4-(3,5-Dimethyl-1H-pyrazol-1-yl)-3-fluorobenzoic acid, 97%, 4-(3,5-Dimethyl-1H-pyrazol-1-yl)-3-fluorobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-(3,5-dimethylpyrazol-1-yl)-3-fluorobenzoic acid (CAS 1152868-20-6) is a chemical compound with the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. IUPAC name: 4-(3,5-dimethylpyrazol-1-yl)-3-fluorobenzoic acid. InChIKey: BWDANXPJRCVMOB-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O2 |
|---|---|
| Molecular weight | 234.23 g/mol |
| IUPAC name | 4-(3,5-dimethylpyrazol-1-yl)-3-fluorobenzoic acid |
| InChIKey | BWDANXPJRCVMOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=C(C=C2)C(=O)O)F)C |
Computed by PubChem (NCBI)