CAS 1153000-35-1 appears in our catalog under these names: 6-Phenoxy-2-propyl-1,4-dihydroquinolin-4-one, 95%, 6-Phenoxy-2-propyl-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-phenoxy-2-propyl-1H-quinolin-4-one (CAS 1153000-35-1) is a chemical compound with the molecular formula C18H17NO2 and a molecular weight of 279.3 g/mol. IUPAC name: 6-phenoxy-2-propyl-1H-quinolin-4-one. InChIKey: ZSNFTBBLVPRSRI-UHFFFAOYSA-N.
| Molecular formula | C18H17NO2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 6-phenoxy-2-propyl-1H-quinolin-4-one |
| InChIKey | ZSNFTBBLVPRSRI-UHFFFAOYSA-N |
| SMILES | CCCC1=CC(=O)C2=C(N1)C=CC(=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)