Products 1153093-46-9
CAS 1153093-46-9 is the registry number for 4-Chloro-6-methyl-2,2'-bipyrimidine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-chloro-6-methyl-2-pyrimidin-2-ylpyrimidine (CAS 1153093-46-9) is a chemical compound with the molecular formula C9H7ClN4 and a molecular weight of 206.63 g/mol. IUPAC name: 4-chloro-6-methyl-2-pyrimidin-2-ylpyrimidine. InChIKey: AQRZLGUVRPSCRO-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN4 |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 4-chloro-6-methyl-2-pyrimidin-2-ylpyrimidine |
| InChIKey | AQRZLGUVRPSCRO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C2=NC=CC=N2)Cl |
Computed by PubChem (NCBI)