Products 769971-54-2
CAS 769971-54-2 is the registry number for 6-Chloro-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonitrile (CAS 769971-54-2) is a chemical compound with the molecular formula C9H7ClN4 and a molecular weight of 206.63 g/mol. IUPAC name: 6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonitrile. InChIKey: ZFVCTMZYYFMTSL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN4 |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonitrile |
| InChIKey | ZFVCTMZYYFMTSL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C(=N2)Cl)C#N)C |
Computed by PubChem (NCBI)