CAS 886497-46-7 appears in our catalog under these names: 5-(4-Chlorophenyl)-1,2,4-triazin-3-amine, 95+%, 5-(4-Chlorophenyl)-1,2,4-triazin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-(4-chlorophenyl)-1,2,4-triazin-3-amine (CAS 886497-46-7) is a chemical compound with the molecular formula C9H7ClN4 and a molecular weight of 206.63 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,2,4-triazin-3-amine. InChIKey: IPZNMPRJRFYAJB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN4 |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,2,4-triazin-3-amine |
| InChIKey | IPZNMPRJRFYAJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=NC(=N2)N)Cl |
Computed by PubChem (NCBI)