CAS 1153129-18-0 is the registry number for 2-((1,3-Dimethyl-4-nitro-1H-pyrazol-5-yl)amino)-N-isopropylacetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-N-propan-2-ylacetamide (CAS 1153129-18-0) is a chemical compound with the molecular formula C10H17N5O3 and a molecular weight of 255.27 g/mol. IUPAC name: 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-N-propan-2-ylacetamide. InChIKey: BPSKSIRPHWRYSY-UHFFFAOYSA-N.
| Molecular formula | C10H17N5O3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-N-propan-2-ylacetamide |
| InChIKey | BPSKSIRPHWRYSY-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1[N+](=O)[O-])NCC(=O)NC(C)C)C |
Computed by PubChem (NCBI)