Products 2222775-69-9

CAS 2222775-69-9 is the registry number for Simeton-acetic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

4-[[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]butanoic acid (CAS 2222775-69-9) is a chemical compound with the molecular formula C10H17N5O3 and a molecular weight of 255.27 g/mol. IUPAC name: 4-[[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]butanoic acid. InChIKey: PJQGOQLJADTPMY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17N5O3
Molecular weight255.27 g/mol
IUPAC name4-[[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]butanoic acid
InChIKeyPJQGOQLJADTPMY-UHFFFAOYSA-N
SMILESCCNC1=NC(=NC(=N1)OC)NCCCC(=O)O

Computed by PubChem (NCBI)