Products 863646-43-9

CAS 863646-43-9 is the registry number for tert-Butyl 3-(1h-tetrazol-5-yl)morpholine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(2H-tetrazol-5-yl)morpholine-4-carboxylate (CAS 863646-43-9) is a chemical compound with the molecular formula C10H17N5O3 and a molecular weight of 255.27 g/mol. IUPAC name: tert-butyl 3-(2H-tetrazol-5-yl)morpholine-4-carboxylate. InChIKey: QQLMQFGGRRFIIA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17N5O3
Molecular weight255.27 g/mol
IUPAC nametert-butyl 3-(2H-tetrazol-5-yl)morpholine-4-carboxylate
InChIKeyQQLMQFGGRRFIIA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCOCC1C2=NNN=N2

Computed by PubChem (NCBI)