CAS 1153250-99-7 is the registry number for N-(2,4-Dichlorophenethyl)-1H-pyrazole-4-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(2,4-dichlorophenyl)ethyl]-1H-pyrazole-4-carboxamide (CAS 1153250-99-7) is a chemical compound with the molecular formula C12H11Cl2N3O and a molecular weight of 284.14 g/mol. IUPAC name: N-[2-(2,4-dichlorophenyl)ethyl]-1H-pyrazole-4-carboxamide. InChIKey: WWYXSNSSIZKIKK-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N3O |
|---|---|
| Molecular weight | 284.14 g/mol |
| IUPAC name | N-[2-(2,4-dichlorophenyl)ethyl]-1H-pyrazole-4-carboxamide |
| InChIKey | WWYXSNSSIZKIKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CCNC(=O)C2=CNN=C2 |
Computed by PubChem (NCBI)