Products 477870-62-5
CAS 477870-62-5 is the registry number for (2Z)-2-Cyano-n-(3,5-dichlorophenyl)-3-(dimethylamino)prop-2-enamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-2-cyano-N-(3,5-dichlorophenyl)-3-(dimethylamino)prop-2-enamide (CAS 477870-62-5) is a chemical compound with the molecular formula C12H11Cl2N3O and a molecular weight of 284.14 g/mol. IUPAC name: (Z)-2-cyano-N-(3,5-dichlorophenyl)-3-(dimethylamino)prop-2-enamide. InChIKey: NJQDDPIDMBHIFF-FPLPWBNLSA-N.
| Molecular formula | C12H11Cl2N3O |
|---|---|
| Molecular weight | 284.14 g/mol |
| IUPAC name | (Z)-2-cyano-N-(3,5-dichlorophenyl)-3-(dimethylamino)prop-2-enamide |
| InChIKey | NJQDDPIDMBHIFF-FPLPWBNLSA-N |
| SMILES | CN(C)/C=C(/C#N)\C(=O)NC1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)