CAS 1374509-56-4 is the registry number for 2-[(2,4-Dichlorophenyl)amino]-5,6-dimethylpyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,4-dichloroanilino)-4,5-dimethyl-1H-pyrimidin-6-one (CAS 1374509-56-4) is a chemical compound with the molecular formula C12H11Cl2N3O and a molecular weight of 284.14 g/mol. IUPAC name: 2-(2,4-dichloroanilino)-4,5-dimethyl-1H-pyrimidin-6-one. InChIKey: WWIDBHPOQVFWKA-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N3O |
|---|---|
| Molecular weight | 284.14 g/mol |
| IUPAC name | 2-(2,4-dichloroanilino)-4,5-dimethyl-1H-pyrimidin-6-one |
| InChIKey | WWIDBHPOQVFWKA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(NC1=O)NC2=C(C=C(C=C2)Cl)Cl)C |
Computed by PubChem (NCBI)