CAS 1153411-04-1 is the registry number for 4-Chloro-2-(2,6-dichlorophenyl)-6-methylpyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-2-(2,6-dichlorophenyl)-6-methylpyrimidine (CAS 1153411-04-1) is a chemical compound with the molecular formula C11H7Cl3N2 and a molecular weight of 273.5 g/mol. IUPAC name: 4-chloro-2-(2,6-dichlorophenyl)-6-methylpyrimidine. InChIKey: UMIYGJNQGRBBNS-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl3N2 |
|---|---|
| Molecular weight | 273.5 g/mol |
| IUPAC name | 4-chloro-2-(2,6-dichlorophenyl)-6-methylpyrimidine |
| InChIKey | UMIYGJNQGRBBNS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C2=C(C=CC=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)