CAS 146532-97-0 is the registry number for 4,6-Dichloro-5-(4-chlorophenyl)-2-methylpyrimidine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4,6-dichloro-5-(4-chlorophenyl)-2-methylpyrimidine (CAS 146532-97-0) is a chemical compound with the molecular formula C11H7Cl3N2 and a molecular weight of 273.5 g/mol. IUPAC name: 4,6-dichloro-5-(4-chlorophenyl)-2-methylpyrimidine. InChIKey: VFIRWLYURJFIIX-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl3N2 |
|---|---|
| Molecular weight | 273.5 g/mol |
| IUPAC name | 4,6-dichloro-5-(4-chlorophenyl)-2-methylpyrimidine |
| InChIKey | VFIRWLYURJFIIX-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C(=N1)Cl)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)