CAS 2270909-89-0 is the registry number for 2-Chloro-4-(3,5-dichloro-benzyl)-pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-4-[(3,5-dichlorophenyl)methyl]pyrimidine (CAS 2270909-89-0) is a chemical compound with the molecular formula C11H7Cl3N2 and a molecular weight of 273.5 g/mol. IUPAC name: 2-chloro-4-[(3,5-dichlorophenyl)methyl]pyrimidine. InChIKey: MRVQAPOEUFJGQZ-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl3N2 |
|---|---|
| Molecular weight | 273.5 g/mol |
| IUPAC name | 2-chloro-4-[(3,5-dichlorophenyl)methyl]pyrimidine |
| InChIKey | MRVQAPOEUFJGQZ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1CC2=CC(=CC(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)