CAS 1153429-79-8 appears in our catalog under these names: 5-(Chloromethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole, 95%, 5-(Chloromethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(chloromethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole (CAS 1153429-79-8) is a chemical compound with the molecular formula C9H5ClF2N2O and a molecular weight of 230.60 g/mol. IUPAC name: 5-(chloromethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole. InChIKey: VPOUDELZMHHFBV-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF2N2O |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole |
| InChIKey | VPOUDELZMHHFBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NOC(=N2)CCl)F)F |
Computed by PubChem (NCBI)