CAS 937633-19-7 is the registry number for 2-(Chloromethyl)-5-(2,4-difluorophenyl)-1,3,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
2-(chloromethyl)-5-(2,4-difluorophenyl)-1,3,4-oxadiazole (CAS 937633-19-7) is a chemical compound with the molecular formula C9H5ClF2N2O and a molecular weight of 230.60 g/mol. IUPAC name: 2-(chloromethyl)-5-(2,4-difluorophenyl)-1,3,4-oxadiazole. InChIKey: SUFHNHWSKBLQSF-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF2N2O |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(2,4-difluorophenyl)-1,3,4-oxadiazole |
| InChIKey | SUFHNHWSKBLQSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)