CAS 942035-93-0 appears in our catalog under these names: 3-(Chloromethyl)-5-(2,4-difluorophenyl)-1,2,4-oxadiazole, 95%, 3-(Chloromethyl)-5-(2,4-difluorophenyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(chloromethyl)-5-(2,4-difluorophenyl)-1,2,4-oxadiazole (CAS 942035-93-0) is a chemical compound with the molecular formula C9H5ClF2N2O and a molecular weight of 230.60 g/mol. IUPAC name: 3-(chloromethyl)-5-(2,4-difluorophenyl)-1,2,4-oxadiazole. InChIKey: OJEHETOHWDPGQW-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF2N2O |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | 3-(chloromethyl)-5-(2,4-difluorophenyl)-1,2,4-oxadiazole |
| InChIKey | OJEHETOHWDPGQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)