CAS 1153734-59-8 is the registry number for Ethyl 2-(4-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(4-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate (CAS 1153734-59-8) is a chemical compound with the molecular formula C13H13FN2O2 and a molecular weight of 248.25 g/mol. IUPAC name: ethyl 2-(4-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate. InChIKey: JRYVVDDXLQJBRF-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2O2 |
|---|---|
| Molecular weight | 248.25 g/mol |
| IUPAC name | ethyl 2-(4-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate |
| InChIKey | JRYVVDDXLQJBRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=N1)C2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)