CAS 357325-98-5 is the registry number for N-(4-Fluoro-3-methylphenyl)-3,5-dimethylisoxazole-4-carboxamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-fluoro-3-methylphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (CAS 357325-98-5) is a chemical compound with the molecular formula C13H13FN2O2 and a molecular weight of 248.25 g/mol. IUPAC name: N-(4-fluoro-3-methylphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide. InChIKey: UEVIHGSFNDDPSN-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2O2 |
|---|---|
| Molecular weight | 248.25 g/mol |
| IUPAC name | N-(4-fluoro-3-methylphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| InChIKey | UEVIHGSFNDDPSN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C2=C(ON=C2C)C)F |
Computed by PubChem (NCBI)