CAS 2340293-12-9 is the registry number for 5-(5-Fluoro-2-isopropoxyphenyl)-1h-pyrazole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-(5-fluoro-2-propan-2-yloxyphenyl)-1H-pyrazole-5-carbaldehyde (CAS 2340293-12-9) is a chemical compound with the molecular formula C13H13FN2O2 and a molecular weight of 248.25 g/mol. IUPAC name: 3-(5-fluoro-2-propan-2-yloxyphenyl)-1H-pyrazole-5-carbaldehyde. InChIKey: XBUHYTXQIKNGFY-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2O2 |
|---|---|
| Molecular weight | 248.25 g/mol |
| IUPAC name | 3-(5-fluoro-2-propan-2-yloxyphenyl)-1H-pyrazole-5-carbaldehyde |
| InChIKey | XBUHYTXQIKNGFY-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)F)C2=NNC(=C2)C=O |
Computed by PubChem (NCBI)