Products 1153762-99-2

CAS 1153762-99-2 is the registry number for (2-Cyano-3-fluoro-phenyl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-cyano-3-fluorophenyl)carbamate (CAS 1153762-99-2) is a chemical compound with the molecular formula C12H13FN2O2 and a molecular weight of 236.24 g/mol. IUPAC name: tert-butyl N-(2-cyano-3-fluorophenyl)carbamate. InChIKey: URZIIFNBWLCXJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13FN2O2
Molecular weight236.24 g/mol
IUPAC nametert-butyl N-(2-cyano-3-fluorophenyl)carbamate
InChIKeyURZIIFNBWLCXJJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C(=CC=C1)F)C#N

Computed by PubChem (NCBI)