CAS 861210-34-6 is the registry number for 2-(4-Fluorophenyl)-4-(2-hydroxyethyl)-5-methyl-2,3-dihydro-1h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(4-fluorophenyl)-4-(2-hydroxyethyl)-5-methyl-1H-pyrazol-3-one (CAS 861210-34-6) is a chemical compound with the molecular formula C12H13FN2O2 and a molecular weight of 236.24 g/mol. IUPAC name: 2-(4-fluorophenyl)-4-(2-hydroxyethyl)-5-methyl-1H-pyrazol-3-one. InChIKey: XTNDTHXQZPNHLD-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O2 |
|---|---|
| Molecular weight | 236.24 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-4-(2-hydroxyethyl)-5-methyl-1H-pyrazol-3-one |
| InChIKey | XTNDTHXQZPNHLD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1)C2=CC=C(C=C2)F)CCO |
Computed by PubChem (NCBI)