CAS 92926-32-4 appears in our catalog under these names: 6-Fluorospiro[4h-3,1-benzoxazine-4,4'-piperidin]-2(1h)-one, 95%, 6-Fluorospiro(4H-3,1-benzoxazine-4,4'-piperidin)-2(1H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
6-fluorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one (CAS 92926-32-4) is a chemical compound with the molecular formula C12H13FN2O2 and a molecular weight of 236.24 g/mol. IUPAC name: 6-fluorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one. InChIKey: ZHRWOWCJMFGREP-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O2 |
|---|---|
| Molecular weight | 236.24 g/mol |
| IUPAC name | 6-fluorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one |
| InChIKey | ZHRWOWCJMFGREP-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=CC(=C3)F)NC(=O)O2 |
Computed by PubChem (NCBI)