Products 1153974-98-1
CAS 1153974-98-1 appears in our catalog under these names: 2-Amino-6-bromo-3-fluorobenzoic acid, 98%, 98%, 2-Amino-6-bromo-3-fluorobenzoic acid, 95%, 2-Amino-6-bromo-3-fluoro-benzoic Acid, 2-Amino-6-bromo-3-fluorobenzoic acid, 97%. Offered by: Chemat, Combi-blocks, TRC, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 2,5g.
2-amino-6-bromo-3-fluorobenzoic acid (CAS 1153974-98-1) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-amino-6-bromo-3-fluorobenzoic acid. InChIKey: VZFVWAWYEGYHJI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-amino-6-bromo-3-fluorobenzoic acid |
| InChIKey | VZFVWAWYEGYHJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)N)C(=O)O)Br |
Computed by PubChem (NCBI)