Products 1154010-13-5
CAS 1154010-13-5 is the registry number for 2-Chloro-N-(1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl)propanamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]propanamide (CAS 1154010-13-5) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]propanamide. InChIKey: MBSXVKJHRIBPIO-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]propanamide |
| InChIKey | MBSXVKJHRIBPIO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)OCCO2)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)