Products 1154030-73-5

CAS 1154030-73-5 is the registry number for Ethyl 3-(dimethylamino)-2-(4-cyano-1h-1,2,3-triazol-1-yl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-cyanotriazol-1-yl)-3-(dimethylamino)prop-2-enoate (CAS 1154030-73-5) is a chemical compound with the molecular formula C10H13N5O2 and a molecular weight of 235.24 g/mol. IUPAC name: ethyl 2-(4-cyanotriazol-1-yl)-3-(dimethylamino)prop-2-enoate. InChIKey: ZQOBTQXOHGZNRL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13N5O2
Molecular weight235.24 g/mol
IUPAC nameethyl 2-(4-cyanotriazol-1-yl)-3-(dimethylamino)prop-2-enoate
InChIKeyZQOBTQXOHGZNRL-UHFFFAOYSA-N
SMILESCCOC(=O)C(=CN(C)C)N1C=C(N=N1)C#N

Computed by PubChem (NCBI)