CAS 136675-82-6 appears in our catalog under these names: N2-Pivaloylguanine, 95%, N2-Pivaloylguanine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 1g, 50g, 100g, 250g.
2,2-dimethyl-N-(6-oxo-1,7-dihydropurin-2-yl)propanamide (CAS 136675-82-6) is a chemical compound with the molecular formula C10H13N5O2 and a molecular weight of 235.24 g/mol. IUPAC name: 2,2-dimethyl-N-(6-oxo-1,7-dihydropurin-2-yl)propanamide. InChIKey: XGIQXUWLRNVMLK-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O2 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 2,2-dimethyl-N-(6-oxo-1,7-dihydropurin-2-yl)propanamide |
| InChIKey | XGIQXUWLRNVMLK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC2=C(C(=O)N1)NC=N2 |
Computed by PubChem (NCBI)