CAS 125409-63-4 is the registry number for (1R,2S,3R)-3-(6-Amino-9H-purin-9-yl)cyclopentane-1,2-diol, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
(1R,2S,3R)-3-(6-aminopurin-9-yl)cyclopentane-1,2-diol (CAS 125409-63-4) is a chemical compound with the molecular formula C10H13N5O2 and a molecular weight of 235.24 g/mol. IUPAC name: (1R,2S,3R)-3-(6-aminopurin-9-yl)cyclopentane-1,2-diol. InChIKey: CZASVOKHBMDKGF-JKMUOGBPSA-N.
| Molecular formula | C10H13N5O2 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | (1R,2S,3R)-3-(6-aminopurin-9-yl)cyclopentane-1,2-diol |
| InChIKey | CZASVOKHBMDKGF-JKMUOGBPSA-N |
| SMILES | C1C[C@H]([C@H]([C@@H]1N2C=NC3=C(N=CN=C32)N)O)O |
Computed by PubChem (NCBI)