Products 115406-23-0
CAS 115406-23-0 is the registry number for SCH-39370. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[(2S)-1-[(2-carboxy-2-hydroxyethyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-4-phenylbutanoic acid (CAS 115406-23-0) is a chemical compound with the molecular formula C22H26N2O6 and a molecular weight of 414.5 g/mol. IUPAC name: 2-[[(2S)-1-[(2-carboxy-2-hydroxyethyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-4-phenylbutanoic acid. InChIKey: QAQRHURCJWHRJU-XBMUEBEBSA-N.
| Molecular formula | C22H26N2O6 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 2-[[(2S)-1-[(2-carboxy-2-hydroxyethyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-4-phenylbutanoic acid |
| InChIKey | QAQRHURCJWHRJU-XBMUEBEBSA-N |
| SMILES | C1=CC=C(C=C1)CCC(C(=O)O)N[C@@H](CC2=CC=CC=C2)C(=O)NCC(C(=O)O)O |
Computed by PubChem (NCBI)