Products 55533-25-0
CAS 55533-25-0 appears in our catalog under these names: Boc-phe(4-nhz)-oh, 98%, Boc-l-phe(4-nhz)-oh dcha, 98%, Boc-Phe(4-NHZ)-OH, 98+%, Boc–p–amino–Phe(Z)–OH, Boc-Phe(4-NHZ)-OH, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(phenylmethoxycarbonylamino)phenyl]propanoic acid (CAS 55533-25-0) is a chemical compound with the molecular formula C22H26N2O6 and a molecular weight of 414.5 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(phenylmethoxycarbonylamino)phenyl]propanoic acid. InChIKey: VEVIIGJEOXYKAV-SFHVURJKSA-N.
| Molecular formula | C22H26N2O6 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(phenylmethoxycarbonylamino)phenyl]propanoic acid |
| InChIKey | VEVIIGJEOXYKAV-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)