Products 58773-45-8

CAS 58773-45-8 is the registry number for (3R)-3,6-Bis[[(phenylmethoxy)carbonyl]amino]hexanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3R)-3,6-bis(phenylmethoxycarbonylamino)hexanoic acid (CAS 58773-45-8) is a chemical compound with the molecular formula C22H26N2O6 and a molecular weight of 414.5 g/mol. IUPAC name: (3R)-3,6-bis(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: LHJJHUUMPVVEBX-LJQANCHMSA-N.

Identity
Molecular formulaC22H26N2O6
Molecular weight414.5 g/mol
IUPAC name(3R)-3,6-bis(phenylmethoxycarbonylamino)hexanoic acid
InChIKeyLHJJHUUMPVVEBX-LJQANCHMSA-N
SMILESC1=CC=C(C=C1)COC(=O)NCCC[C@H](CC(=O)O)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)