CAS 115416-53-0 appears in our catalog under these names: (S)-N-(5-Nitro-2-pyridyl)phenylalaninol, 95%, (S)–2–((5–nitropyridin–2–yl)amino)–3–phenylpropan–1–ol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g.
(2S)-2-[(5-nitro-2-pyridinyl)amino]-3-phenylpropan-1-ol (CAS 115416-53-0) is a chemical compound with the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. IUPAC name: (2S)-2-[(5-nitro-2-pyridinyl)amino]-3-phenylpropan-1-ol. InChIKey: XQQHMEFZBTXUTC-LBPRGKRZSA-N.
| Molecular formula | C14H15N3O3 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | (2S)-2-[(5-nitro-2-pyridinyl)amino]-3-phenylpropan-1-ol |
| InChIKey | XQQHMEFZBTXUTC-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CO)NC2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)