CAS 442571-86-0 is the registry number for 5-Cyclohexyl-3-(3-nitrophenyl)-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.
5-cyclohexyl-3-(3-nitrophenyl)-1,2,4-oxadiazole (CAS 442571-86-0) is a chemical compound with the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. IUPAC name: 5-cyclohexyl-3-(3-nitrophenyl)-1,2,4-oxadiazole. InChIKey: WQLIQMGJEJUWCQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O3 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | 5-cyclohexyl-3-(3-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | WQLIQMGJEJUWCQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC(=NO2)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)