CAS 3005-62-7 appears in our catalog under these names: Bz-his-ome, 98%, (S)-Methyl 2-benzamido-3-(1H-imidazol-4-yl)propanoate, 97%, Bz–His–OMe, Bz-L-His-OMe, Bz-His-OMe, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 25g, 100g, 5g, 1g.
Methyl (2S)-2-benzamido-3-(1H-imidazol-5-yl)propanoate (CAS 3005-62-7) is a chemical compound with the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. IUPAC name: methyl (2S)-2-benzamido-3-(1H-imidazol-5-yl)propanoate. InChIKey: POUMRJPRROOAGQ-LBPRGKRZSA-N.
| Molecular formula | C14H15N3O3 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | methyl (2S)-2-benzamido-3-(1H-imidazol-5-yl)propanoate |
| InChIKey | POUMRJPRROOAGQ-LBPRGKRZSA-N |
| SMILES | COC(=O)[C@H](CC1=CN=CN1)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)