Products 1154178-68-3
CAS 1154178-68-3 appears in our catalog under these names: 1–(3，5–dimethylphenyl)cyclobutane–1–carbonitrile, Cyclobutanecarbonitrile, 1-(3,5-dimethylphenyl)-. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
1-(3,5-dimethylphenyl)cyclobutane-1-carbonitrile (CAS 1154178-68-3) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)cyclobutane-1-carbonitrile. InChIKey: TZGPUBAOEMALJE-UHFFFAOYSA-N.
| Molecular formula | C13H15N |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)cyclobutane-1-carbonitrile |
| InChIKey | TZGPUBAOEMALJE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2(CCC2)C#N)C |
Computed by PubChem (NCBI)